2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid
Modify Date: 2025-09-18 15:22:45
![2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid Structure](https://image.chemsrc.com/caspic/149/21340-66-9.png)
2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid structure
|
Common Name | 2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid | ||
|---|---|---|---|---|
| CAS Number | 21340-66-9 | Molecular Weight | 290.74200 | |
| Density | 1.237g/cm3 | Boiling Point | 440.6ºC at 760 mmHg | |
| Molecular Formula | C16H15ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 220.3ºC | |
| Name | 2-[4-(4-chlorophenyl)phenoxy]-2-methylpropanoic acid |
|---|
| Density | 1.237g/cm3 |
|---|---|
| Boiling Point | 440.6ºC at 760 mmHg |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.74200 |
| Flash Point | 220.3ºC |
| Exact Mass | 290.07100 |
| PSA | 46.53000 |
| LogP | 4.24900 |
| Vapour Pressure | 1.53E-08mmHg at 25°C |
| Index of Refraction | 1.577 |
| InChIKey | BWXVFPRJHCRVKA-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(-c2ccc(Cl)cc2)cc1)C(=O)O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |