4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid
Modify Date: 2025-11-02 17:18:29
4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid structure
|
Common Name | 4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 2134-91-0 | Molecular Weight | 212.15600 | |
| Density | 1.549g/cm3 | Boiling Point | 455.6ºC at 760mmHg | |
| Molecular Formula | C9H8O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 188.2ºC | |
| Name | 4-hydroxy-5-methoxybenzene-1,3-dicarboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.549g/cm3 |
|---|---|
| Boiling Point | 455.6ºC at 760mmHg |
| Molecular Formula | C9H8O6 |
| Molecular Weight | 212.15600 |
| Flash Point | 188.2ºC |
| Exact Mass | 212.03200 |
| PSA | 104.06000 |
| LogP | 0.79720 |
| Vapour Pressure | 4.29E-09mmHg at 25°C |
| Index of Refraction | 1.629 |
| InChIKey | NLSSJYQPZIQJNC-UHFFFAOYSA-N |
| SMILES | COc1cc(C(=O)O)cc(C(=O)O)c1O |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Hydroxy-5-methoxy-isophthalsaeure |
| 5-Carboxy-vanilinsaeure |
| 4-hydroxy-5-methoxy-isophthalic acid |
| 5-Carboxyvanillic acid |
| 5-Carboxy-vanillinsaeure |
| 5-carboxyvanillate |
| 4-Hydroxy-5-methoxyisophthalate |
| EINECS 218-366-7 |