phenyl N-(4-fluorosulfonyl-3-methyl-phenyl)carbamate
Modify Date: 2025-09-22 21:02:08
phenyl N-(4-fluorosulfonyl-3-methyl-phenyl)carbamate structure
|
Common Name | phenyl N-(4-fluorosulfonyl-3-methyl-phenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 21322-77-0 | Molecular Weight | 309.31300 | |
| Density | 1.397g/cm3 | Boiling Point | 401.2ºC at 760 mmHg | |
| Molecular Formula | C14H12FNO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.4ºC | |
| Name | phenyl-N-(3-methyl-2-(phenylselanyl)butylidene)methanamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.397g/cm3 |
|---|---|
| Boiling Point | 401.2ºC at 760 mmHg |
| Molecular Formula | C14H12FNO4S |
| Molecular Weight | 309.31300 |
| Flash Point | 196.4ºC |
| Exact Mass | 309.04700 |
| PSA | 80.85000 |
| LogP | 4.41790 |
| Vapour Pressure | 1.2E-06mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | FSBOFAUYGBDMLU-UHFFFAOYSA-N |
| SMILES | Cc1cc(NC(=O)Oc2ccccc2)ccc1S(=O)(=O)F |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Benzenemethanamine,N-[3-methyl-2-(phenylseleno)butylidene] |
| Phenyl-N-(3-methyl-4-fluorsulfonyl-phenyl)-urethan |