2,4-diamino-5,6-dihydro-6,6-dimethyl-5-(4'-methoxyphenyl)-s-triazine structure
|
Common Name | 2,4-diamino-5,6-dihydro-6,6-dimethyl-5-(4'-methoxyphenyl)-s-triazine | ||
|---|---|---|---|---|
| CAS Number | 21316-30-3 | Molecular Weight | 247.29600 | |
| Density | 1.28g/cm3 | Boiling Point | 411ºC at 760 mmHg | |
| Molecular Formula | C12H17N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 202.4ºC | |
| Name | 1-(4-methoxyphenyl)-6,6-dimethyl-1,3,5-triazine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 411ºC at 760 mmHg |
| Molecular Formula | C12H17N5O |
| Molecular Weight | 247.29600 |
| Flash Point | 202.4ºC |
| Exact Mass | 247.14300 |
| PSA | 84.23000 |
| LogP | 2.22210 |
| Vapour Pressure | 5.78E-07mmHg at 25°C |
| Index of Refraction | 1.627 |
| InChIKey | KLCSZLKQTXQCTD-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2C(N)=NC(N)=NC2(C)C)cc1 |
| HS Code | 2933699090 |
|---|
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| GNF-Pf-806 |