1-O-benzyl 4-O-tert-butyl (2S)-2-aminobutanedioate
Modify Date: 2025-09-10 12:39:18
1-O-benzyl 4-O-tert-butyl (2S)-2-aminobutanedioate structure
|
Common Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-aminobutanedioate | ||
|---|---|---|---|---|
| CAS Number | 2131-29-5 | Molecular Weight | 279.33200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-O-benzyl 4-O-tert-butyl (2S)-2-aminobutanedioate |
|---|
| Molecular Formula | C15H21NO4 |
|---|---|
| Molecular Weight | 279.33200 |
| Exact Mass | 279.14700 |
| PSA | 78.62000 |
| LogP | 2.48920 |
| InChIKey | LUPVGUVBPZBXKG-LBPRGKRZSA-N |
| SMILES | CC(C)(C)OC(=O)CC(N)C(=O)OCc1ccccc1 |
| HS Code | 2922499990 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:5545-52-8
CAS#:3057-74-7
CAS#:1676-90-0| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |