Solvent Red 149
Modify Date: 2025-08-26 18:44:51
Solvent Red 149 structure
|
Common Name | Solvent Red 149 | ||
|---|---|---|---|---|
| CAS Number | 21295-57-8 | Molecular Weight | 358.43300 | |
| Density | 1.31 | Boiling Point | 597.8ºC at 760 mmHg | |
| Molecular Formula | C23H22N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.4ºC | |
| Name | 6-cyclohexylamino-3-methyl-3H-naphtho[1,2,3-de]quinoline-2,7-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31 |
|---|---|
| Boiling Point | 597.8ºC at 760 mmHg |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.43300 |
| Flash Point | 315.4ºC |
| Exact Mass | 358.16800 |
| PSA | 51.10000 |
| LogP | 4.46050 |
| Vapour Pressure | 2.96E-14mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | JZGUXCXDBKBCDN-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)cc2c3c(c(NC4CCCCC4)ccc31)C(=O)c1ccccc1-2 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 244-320-0 |
| 6-Cyclohexylamino-3-N-methylanthrapyridon |
| CCG-2768 |