1-(3-chloropropyl)-4-(4-methoxyphenyl)piperazine
Modify Date: 2025-09-19 02:26:28
1-(3-chloropropyl)-4-(4-methoxyphenyl)piperazine structure
|
Common Name | 1-(3-chloropropyl)-4-(4-methoxyphenyl)piperazine | ||
|---|---|---|---|---|
| CAS Number | 21279-79-8 | Molecular Weight | 268.78200 | |
| Density | 1.109g/cm3 | Boiling Point | 406.4ºC at 760 mmHg | |
| Molecular Formula | C14H21ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.6ºC | |
| Name | 1-(3-chloropropyl)-4-(4-methoxyphenyl)piperazine |
|---|
| Density | 1.109g/cm3 |
|---|---|
| Boiling Point | 406.4ºC at 760 mmHg |
| Molecular Formula | C14H21ClN2O |
| Molecular Weight | 268.78200 |
| Flash Point | 199.6ºC |
| Exact Mass | 268.13400 |
| PSA | 15.71000 |
| LogP | 2.44900 |
| Vapour Pressure | 8.17E-07mmHg at 25°C |
| Index of Refraction | 1.535 |
| InChIKey | MSMRLFVBNHULKL-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(CCCCl)CC2)cc1 |
| HS Code | 2933599090 |
|---|
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |