2,6,7-trichloro-3-methylquinoxaline structure
|
Common Name | 2,6,7-trichloro-3-methylquinoxaline | ||
|---|---|---|---|---|
| CAS Number | 212771-50-1 | Molecular Weight | 247.50800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H5Cl3N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,6,7-trichloro-3-methylquinoxaline |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H5Cl3N2 |
|---|---|
| Molecular Weight | 247.50800 |
| Exact Mass | 245.95200 |
| PSA | 25.78000 |
| LogP | 3.89840 |
| InChIKey | BGHYEKFIVMFWRP-UHFFFAOYSA-N |
| SMILES | Cc1nc2cc(Cl)c(Cl)cc2nc1Cl |
|
~64%
2,6,7-trichloro... CAS#:212771-50-1 |
| Literature: Guillon; Louchahi-Raoul; Boulouard; Dallemagne; Daoust; Rault Pharmacy and Pharmacology Communications, 1998 , vol. 4, # 7 p. 319 - 324 |
|
~%
2,6,7-trichloro... CAS#:212771-50-1 |
| Literature: Guillon; Louchahi-Raoul; Boulouard; Dallemagne; Daoust; Rault Pharmacy and Pharmacology Communications, 1998 , vol. 4, # 7 p. 319 - 324 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| Quinoxaline,2,6,7-trichloro-3-methyl |