tert-butyl (2R)-2-amino-4-oxo-2-phenylbutanoate structure
|
Common Name | tert-butyl (2R)-2-amino-4-oxo-2-phenylbutanoate | ||
|---|---|---|---|---|
| CAS Number | 212560-65-1 | Molecular Weight | 249.306 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 371.9±35.0 °C at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 178.7±25.9 °C | |
| Name | (R)-tert-butyl (3-oxo-1-phenylpropyl)carbamate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 371.9±35.0 °C at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.306 |
| Flash Point | 178.7±25.9 °C |
| Exact Mass | 249.136490 |
| PSA | 55.40000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.508 |
| InChIKey | ZGPCDZZHEWGTEU-GFCCVEGCSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC=O)c1ccccc1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-Methyl-2-propanyl [(1R)-3-oxo-1-phenylpropyl]carbamate |
| tert-butyl N-[(1R)-3-oxo-1-phenylpropyl]carbamate |
| Boc-R-3-amino-3-phenylpropanal |
| Carbamic acid, N-[(1R)-3-oxo-1-phenylpropyl]-, 1,1-dimethylethyl ester |