tert-butyl 2-chlorobenzenecarboperoxoate
Modify Date: 2024-04-04 16:46:44
tert-butyl 2-chlorobenzenecarboperoxoate structure
|
Common Name | tert-butyl 2-chlorobenzenecarboperoxoate | ||
|---|---|---|---|---|
| CAS Number | 2123-90-2 | Molecular Weight | 228.67200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H13ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 2-chlorobenzenecarboperoxoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H13ClO3 |
|---|---|
| Molecular Weight | 228.67200 |
| Exact Mass | 228.05500 |
| PSA | 35.53000 |
| LogP | 3.22690 |
| InChIKey | JWKRCBAZFRUMSY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OOC(=O)c1ccccc1Cl |
| HS Code | 2918300090 |
|---|
|
~97%
tert-butyl 2-ch... CAS#:2123-90-2 |
| Literature: Andrus, Merritt B.; Chen, Xi Tetrahedron, 1997 , vol. 53, # 48 p. 16229 - 16240 |
|
~81%
tert-butyl 2-ch... CAS#:2123-90-2 |
| Literature: Wei, Wei; Zhang, Chao; Xu, Yuan; Wan, Xiaobing Chemical Communications, 2011 , vol. 47, # 38 p. 10827 - 10829 |
CAS#:529-33-9
CAS#:529-34-0| HS Code | 2918300090 |
|---|---|
| Summary | 2918300090 other carboxylic acids with aldehyde or ketone function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| o-Chlorperbenzoesaeure-tert.butylester |
| tert-butyl peroxy-o-chlorobenzoate |
| 2-Chlor-perbenzoesaeure-tert.butylester |
| o-Chlor-benzoesaeure-t-butylester |
| Benzenecarboperoxoic acid,2-chloro-,1,1-dimethylethyl ester |
| t-butyl o-chloroperbenzoate |
| o-Chlorbenzoesaeure-tert.-butylperoxyester |