4-Phenoxybenzoic acid methyl ester
Modify Date: 2025-08-28 12:38:32
4-Phenoxybenzoic acid methyl ester structure
|
Common Name | 4-Phenoxybenzoic acid methyl ester | ||
|---|---|---|---|---|
| CAS Number | 21218-94-0 | Molecular Weight | 228.24300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Methyl 4-phenoxybenzoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H12O3 |
|---|---|
| Molecular Weight | 228.24300 |
| Exact Mass | 228.07900 |
| PSA | 35.53000 |
| LogP | 3.26550 |
| InChIKey | XMXLYEKPSHVLKD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(Oc2ccccc2)cc1 |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Phenoxy-benzoesaeure-methylester |
| 4-Phenoxy-benzoic acid methyl ester |
| 4'-Carbomethoxy-diphenylaether |
| Methyl-p-phenoxy-benzoat |
| p-Phenoxybenzoesaeuremethylester |
| Benzoic acid,p-phenoxy-,methyl ester |