1-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]-1-methyl-3,4,5,6-tetrahydro-2H-pyridine bromide structure
|
Common Name | 1-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]-1-methyl-3,4,5,6-tetrahydro-2H-pyridine bromide | ||
|---|---|---|---|---|
| CAS Number | 21216-78-4 | Molecular Weight | 465.36800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H28INO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[(2,2-diphenyl-1,3-dioxolan-4-yl)methyl]-1-methylpiperidin-1-ium,iodide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C22H28INO2 |
|---|---|
| Molecular Weight | 465.36800 |
| Exact Mass | 465.11600 |
| PSA | 18.46000 |
| LogP | 0.89640 |
| InChIKey | NOXZRZKBAKQQAL-UHFFFAOYSA-M |
| SMILES | C[N+]1(CC2COC(c3ccccc3)(c3ccccc3)O2)CCCCC1.[I-] |
| HS Code | 2933399090 |
|---|
|
~%
1-[(2,2-dipheny... CAS#:21216-78-4 |
| Literature: Blicke; Anderson Journal of the American Chemical Society, 1952 , vol. 74, p. 1733,1735 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Diphenylpiperidinomethyldioxolan iodide |
| ANC-53 |
| Anacolin |
| 2,2-Diphenyl-4-piperidinomethyl-dioxolane-1,3 methiodide |