methyl 3-hydroxy-1,1-dioxo-1-benzothiophene-2-carboxylate
Modify Date: 2025-09-28 08:39:13
methyl 3-hydroxy-1,1-dioxo-1-benzothiophene-2-carboxylate structure
|
Common Name | methyl 3-hydroxy-1,1-dioxo-1-benzothiophene-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 21211-28-9 | Molecular Weight | 240.23300 | |
| Density | 1.592g/cm3 | Boiling Point | 435.7ºC at 760mmHg | |
| Molecular Formula | C10H8O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 217.3ºC | |
| Name | methyl 3-hydroxy-1,1-dioxo-1-benzothiophene-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.592g/cm3 |
|---|---|
| Boiling Point | 435.7ºC at 760mmHg |
| Molecular Formula | C10H8O5S |
| Molecular Weight | 240.23300 |
| Flash Point | 217.3ºC |
| Exact Mass | 240.00900 |
| PSA | 89.05000 |
| LogP | 1.95430 |
| Vapour Pressure | 2.31E-08mmHg at 25°C |
| Index of Refraction | 1.648 |
| InChIKey | HJCMWOVPTCMTMC-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(O)c2ccccc2S1(=O)=O |
| HS Code | 2934999090 |
|---|
|
~74%
methyl 3-hydrox... CAS#:21211-28-9 |
| Literature: Svoboda, Jiri; Nic, Miloslav; Palecek, Jaroslav Collection of Czechoslovak Chemical Communications, 1993 , vol. 58, # 3 p. 592 - 599 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| EINECS 244-272-0 |
| Methyl 1,1-dioxy-3-hydroxythianaphthene-2-carboxylate |