N,N-dimethyl-4-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)aniline,iodide structure
|
Common Name | N,N-dimethyl-4-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)aniline,iodide | ||
|---|---|---|---|---|
| CAS Number | 21176-81-8 | Molecular Weight | 374.28400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H19IN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N,N-dimethyl-4-(3,4,5-trimethyl-1,3-thiazol-3-ium-2-yl)aniline,iodide |
|---|
| Molecular Formula | C14H19IN2S |
|---|---|
| Molecular Weight | 374.28400 |
| Exact Mass | 374.03100 |
| PSA | 36.18000 |
| InChIKey | VHNRYQNAJBCTAP-UHFFFAOYSA-M |
| SMILES | Cc1sc(-c2ccc(N(C)C)cc2)[n+](C)c1C.[I-] |
| HS Code | 2934100090 |
|---|
|
~%
N,N-dimethyl-4-... CAS#:21176-81-8 |
| Literature: Garmaise,D.L. et al. Journal of Medicinal Chemistry, 1968 , vol. 11, # 6 p. 1205 - 1208 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |