SEN-177
Modify Date: 2025-09-19 16:43:54
SEN-177 structure
|
Common Name | SEN-177 | ||
|---|---|---|---|---|
| CAS Number | 2117405-13-5 | Molecular Weight | 338.382 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 581.3±60.0 °C at 760 mmHg | |
| Molecular Formula | C18H19FN6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 305.3±32.9 °C | |
Use of SEN-177SEN177 is an inhibitor of glutaminyl cyclase (QPCT), thereby rescuing the Huntington's disease (HD)-related phenotypes in cell. |
| Name | SEN177 |
|---|---|
| Synonym | More Synonyms |
| Description | SEN177 is an inhibitor of glutaminyl cyclase (QPCT), thereby rescuing the Huntington's disease (HD)-related phenotypes in cell. |
|---|---|
| In Vitro | SEN177 is a Glutaminyl cyclase (QPCT) inhibitor. Glutaminyl cyclase modifies N-terminal glutamine or glutamate residues to N-terminal 5-oxoproline or pyroglutamate (named QPCT). QPCT inhibits mutant huntingtin from forming aggregates, but also reduces aggregation of other aggregate-prone proteins containing polyQ or polyA repeats. SEN177 caused dose-dependent decreases in HTT aggregation by a mechanism that requires QPCT inhibition. SEN177 had in vitro activity against polyglutamine toxicity and was able to reduce aggregates in mammalian cells, primary neurons and in a Drosophila model. |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 581.3±60.0 °C at 760 mmHg |
| Molecular Formula | C18H19FN6 |
| Molecular Weight | 338.382 |
| Flash Point | 305.3±32.9 °C |
| Exact Mass | 338.165527 |
| LogP | 1.12 |
| Vapour Pressure | 0.0±1.6 mmHg at 25°C |
| Index of Refraction | 1.683 |
| InChIKey | AJIAMIPUWJQSPR-UHFFFAOYSA-N |
| SMILES | Cn1cnnc1C1CCN(c2ncccc2-c2ccc(F)nc2)CC1 |
| 3',3'']terpyridine |
| SEN177 |
| MFCD30343871 |
| Piperidine, 1-(6'-fluoro[3,3'-bipyridin]-2-yl)-4-(4-methyl-4H-1,2,4-triazol-3-yl)- |
| 6'-Fluoro-2-[4-(4-methyl-4H-1,2,4-triazol-3-yl)-1-piperidinyl]-3,3'-bipyridine |
| 6''-Fluoro-4-(4-methyl-4H-[1,2,4]triazol-3-yl)-3,4,5,6-tetrahydro-2H-[1,2' |
| 6''-fluoro-4-(4-methyl-4H-[1,2,4]triazol-3-yl)-3,4,5,6-tetrahydro-2H-[1,2';3',3'']terpyridine |