1-(4-chlorophenyl)sulfanyl-N-phenyl-methanethioamide
Modify Date: 2025-09-18 03:25:27
1-(4-chlorophenyl)sulfanyl-N-phenyl-methanethioamide structure
|
Common Name | 1-(4-chlorophenyl)sulfanyl-N-phenyl-methanethioamide | ||
|---|---|---|---|---|
| CAS Number | 21167-85-1 | Molecular Weight | 279.80800 | |
| Density | 1.36g/cm3 | Boiling Point | 404.8ºC at 760mmHg | |
| Molecular Formula | C13H10ClNS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198.6ºC | |
| Name | (4-chlorophenyl) N-phenylcarbamodithioate |
|---|
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 404.8ºC at 760mmHg |
| Molecular Formula | C13H10ClNS2 |
| Molecular Weight | 279.80800 |
| Flash Point | 198.6ºC |
| Exact Mass | 278.99400 |
| PSA | 69.42000 |
| LogP | 4.90210 |
| Vapour Pressure | 9.19E-07mmHg at 25°C |
| Index of Refraction | 1.705 |
| InChIKey | GYDVEUINDWKQLV-UHFFFAOYSA-N |
| SMILES | S=C(Nc1ccccc1)Sc1ccc(Cl)cc1 |
|
~%
1-(4-chlorophen... CAS#:21167-85-1 |
| Literature: Mindl, Jaromir; Sulzer, Jiri; Vecera, Miroslav Collection of Czechoslovak Chemical Communications, 1981 , vol. 46, # 8 p. 1970 - 1975 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |