(fluoren-9-ylideneamino) acetate
Modify Date: 2025-08-26 05:06:31
(fluoren-9-ylideneamino) acetate structure
|
Common Name | (fluoren-9-ylideneamino) acetate | ||
|---|---|---|---|---|
| CAS Number | 21160-07-6 | Molecular Weight | 237.25300 | |
| Density | 1.2g/cm3 | Boiling Point | 414.8ºC at 760 mmHg | |
| Molecular Formula | C15H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 200.9ºC | |
| Name | (fluoren-9-ylideneamino) acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 414.8ºC at 760 mmHg |
| Molecular Formula | C15H11NO2 |
| Molecular Weight | 237.25300 |
| Flash Point | 200.9ºC |
| Exact Mass | 237.07900 |
| PSA | 38.66000 |
| LogP | 2.98250 |
| Vapour Pressure | 4.32E-07mmHg at 25°C |
| Index of Refraction | 1.622 |
| InChIKey | DQOITARARXXHJP-UHFFFAOYSA-N |
| SMILES | CC(=O)ON=C1c2ccccc2-c2ccccc21 |
|
~89%
(fluoren-9-ylid... CAS#:21160-07-6 |
| Literature: Liu, Songbai; Yu, Ying; Liebeskind, Lanny S. Organic Letters, 2007 , vol. 9, # 10 p. 1947 - 1950 |
|
~%
(fluoren-9-ylid... CAS#:21160-07-6 |
| Literature: Kawase,M.; Kikugawa,Y. Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1979 , p. 643 - 645 |
CAS#:10183-82-1| fluoren-9-on-(O-acetyl oxime ) |
| Fluorenon-dibenzylmercaptol |
| Fluoren-9-on-(O-acetyl-oxim) |
| fluoren-9-one-dibenzyldithioacetal |
| fluoren-9-one O-acetyloxime |
| 9H-Fluorene,9,9-bis[(phenylmethyl)thio] |
| fluoren-9-one acetyloxime |
| Fluoren-9-on-dibenzyldithioacetal |
| Fluorenonoximacetat |
| 9.9-Bis-benzylmercapto-fluoren |