1-benzofuran-7-yloxy-3-(propan-2-ylamino)propan-2-ol structure
|
Common Name | 1-benzofuran-7-yloxy-3-(propan-2-ylamino)propan-2-ol | ||
|---|---|---|---|---|
| CAS Number | 21151-91-7 | Molecular Weight | 249.30600 | |
| Density | 1.133g/cm3 | Boiling Point | 398.2ºC at 760 mmHg | |
| Molecular Formula | C14H19NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.6ºC | |
| Name | 1-(1-benzofuran-7-yloxy)-3-(propan-2-ylamino)propan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.133g/cm3 |
|---|---|
| Boiling Point | 398.2ºC at 760 mmHg |
| Molecular Formula | C14H19NO3 |
| Molecular Weight | 249.30600 |
| Flash Point | 194.6ºC |
| Exact Mass | 249.13600 |
| PSA | 54.63000 |
| LogP | 2.56140 |
| Vapour Pressure | 4.69E-07mmHg at 25°C |
| Index of Refraction | 1.561 |
| InChIKey | JSBPDRDKVNCRIK-UHFFFAOYSA-N |
| SMILES | CC(C)NCC(O)COc1cccc2ccoc12 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-benzofuran-7-yloxy-3-isopropylamino-propan-2-ol |
| Bfe-55 |