isoviolastyrene structure
|
Common Name | isoviolastyrene | ||
|---|---|---|---|---|
| CAS Number | 21148-33-4 | Molecular Weight | 270.32300 | |
| Density | 1.137g/cm3 | Boiling Point | 432.5ºC at 760 mmHg | |
| Molecular Formula | C17H18O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 215.4ºC | |
| Name | isoviolastyrene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.137g/cm3 |
|---|---|
| Boiling Point | 432.5ºC at 760 mmHg |
| Molecular Formula | C17H18O3 |
| Molecular Weight | 270.32300 |
| Flash Point | 215.4ºC |
| Exact Mass | 270.12600 |
| PSA | 38.69000 |
| LogP | 3.66530 |
| Vapour Pressure | 4.36E-08mmHg at 25°C |
| Index of Refraction | 1.605 |
| InChIKey | BIOKFCCSNSUOLP-RMKNXTFCSA-N |
| SMILES | COc1cc(OC)c(CC=Cc2ccccc2)cc1O |
| HS Code | 2909500000 |
|---|
| HS Code | 2909500000 |
|---|---|
| Summary | 2909500000 ether-phenols, ether-alcohol-phenols and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 2,4-Dimethoxy-5-[(E)-3-phenyl-2-propenyl]phenol |
| Isoviolastyrol |
| Isoviolastyren |