4-[(2-nitrophenyl)disulfanyl]phenol structure
|
Common Name | 4-[(2-nitrophenyl)disulfanyl]phenol | ||
|---|---|---|---|---|
| CAS Number | 21101-58-6 | Molecular Weight | 279.33500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H9NO3S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-[(2-nitrophenyl)disulfanyl]phenol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H9NO3S2 |
|---|---|
| Molecular Weight | 279.33500 |
| Exact Mass | 279.00200 |
| PSA | 116.65000 |
| LogP | 4.62300 |
| InChIKey | CYPOHDDALWXPEU-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccccc1SSc1ccc(O)cc1 |
|
~%
4-[(2-nitrophen... CAS#:21101-58-6 |
| Literature: Stepanov,B.I. et al. Zhurnal Organicheskoi Khimii, 1977 , vol. 13, p. 370 - 374,334 - 338 |
|
~%
4-[(2-nitrophen... CAS#:21101-58-6 |
| Literature: Oae,S.; Yoshihara,M. Bulletin of the Chemical Society of Japan, 1968 , vol. 41, p. 2082 - 2086 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 4-hydroxy-2'-nitro-diphenyl-1,1'-disulphid |
| 2-Nitro-4'-hydroxydiphenyl-disulfid |