8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione structure
|
Common Name | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione | ||
|---|---|---|---|---|
| CAS Number | 21098-11-3 | Molecular Weight | 257.75600 | |
| Density | 1.18g/cm3 | Boiling Point | 429.4ºC at 760 mmHg | |
| Molecular Formula | C13H20ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 213.5ºC | |
| Name | 8-(4-Chlorobutyl)-8-azaspiro[4.5]decane-7,9-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 429.4ºC at 760 mmHg |
| Molecular Formula | C13H20ClNO2 |
| Molecular Weight | 257.75600 |
| Flash Point | 213.5ºC |
| Exact Mass | 257.11800 |
| PSA | 37.38000 |
| LogP | 2.65270 |
| Vapour Pressure | 1.41E-07mmHg at 25°C |
| Index of Refraction | 1.527 |
| InChIKey | BCNBRBQCDHLCBD-UHFFFAOYSA-N |
| SMILES | O=C1CC2(CCCC2)CC(=O)N1CCCCCl |
| RIDADR | NONH for all modes of transport |
|---|
|
~%
8-(4-Chlorobuty... CAS#:21098-11-3 |
| Literature: American Home Products Corporation Patent: US4812567 A1, 1989 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| Buspirone Impurity 12 |