1-piperidyl N-(3-chlorophenyl)carbamate structure
|
Common Name | 1-piperidyl N-(3-chlorophenyl)carbamate | ||
|---|---|---|---|---|
| CAS Number | 21094-53-1 | Molecular Weight | 254.71300 | |
| Density | 1.28g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C12H15ClN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | piperidin-1-yl N-(3-chlorophenyl)carbamate |
|---|
| Density | 1.28g/cm3 |
|---|---|
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.71300 |
| Exact Mass | 254.08200 |
| PSA | 41.57000 |
| LogP | 3.30030 |
| Index of Refraction | 1.586 |
| InChIKey | VVMIWCHUNBLXIT-UHFFFAOYSA-N |
| SMILES | O=C(Nc1cccc(Cl)c1)ON1CCCCC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |