1-(2-methylbut-3-yn-2-yloxy)-4-nitrobenzene
Modify Date: 2025-08-25 22:29:04
1-(2-methylbut-3-yn-2-yloxy)-4-nitrobenzene structure
|
Common Name | 1-(2-methylbut-3-yn-2-yloxy)-4-nitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 2109-84-4 | Molecular Weight | 205.21000 | |
| Density | 1.172g/cm3 | Boiling Point | 323.201ºC at 760 mmHg | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 142.348ºC | |
| Name | 1-(2-methylbut-3-yn-2-yloxy)-4-nitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.172g/cm3 |
|---|---|
| Boiling Point | 323.201ºC at 760 mmHg |
| Molecular Formula | C11H11NO3 |
| Molecular Weight | 205.21000 |
| Flash Point | 142.348ºC |
| Exact Mass | 205.07400 |
| PSA | 55.05000 |
| LogP | 2.90860 |
| Vapour Pressure | 0.001mmHg at 25°C |
| Index of Refraction | 1.55 |
| InChIKey | KUVSTBAMMGGNND-UHFFFAOYSA-N |
| SMILES | C#CC(C)(C)Oc1ccc([N+](=O)[O-])cc1 |
| HS Code | 2909309090 |
|---|
CAS#:33143-28-1| HS Code | 2909309090 |
|---|---|
| Summary | 2909309090 other aromatic ethers and their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| p-Nitrophenyl-1,1-dimethylpropargylether |