GSK-J2 (sodium salt)
Modify Date: 2024-01-17 18:15:43
GSK-J2 (sodium salt) structure
|
Common Name | GSK-J2 (sodium salt) | ||
|---|---|---|---|---|
| CAS Number | 2108665-15-0 | Molecular Weight | 412.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H23N5O2 Na | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of GSK-J2 (sodium salt)GSK-J2 sodium salt is a pyridine regio-isomer of GSK-J1 which poorly inhibits JMJD3 (IC50 > 100 μM), making it an appropriate negative control for in vitro studies involving GSK-J1. |
| Name | GSK-J2 (sodium salt) |
|---|
| Molecular Formula | C22H23N5O2 Na |
|---|---|
| Molecular Weight | 412.4 |
| InChIKey | LFPRQFGWKMRKLV-UHFFFAOYSA-N |
| SMILES | O=C(O)CCNc1cc(N2CCc3ccccc3CC2)nc(-c2cccnc2)n1.[Na] |