(2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid structure
|
Common Name | (2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 21080-66-0 | Molecular Weight | 285.25000 | |
| Density | 1.654g/cm3 | Boiling Point | 618.535ºC at 760 mmHg | |
| Molecular Formula | C12H15NO7 | Melting Point | >180ºC dec. | |
| MSDS | N/A | Flash Point | 327.878ºC | |
| Name | (2S,3S,4S,5R,6S)-6-(4-aminophenoxy)-3,4,5-trihydroxyoxane-2-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.654g/cm3 |
|---|---|
| Boiling Point | 618.535ºC at 760 mmHg |
| Melting Point | >180ºC dec. |
| Molecular Formula | C12H15NO7 |
| Molecular Weight | 285.25000 |
| Flash Point | 327.878ºC |
| Exact Mass | 285.08500 |
| PSA | 142.47000 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.692 |
| InChIKey | ZARKEMJKQOXOSQ-GOVZDWNOSA-N |
| SMILES | Nc1ccc(OC2OC(C(=O)O)C(O)C(O)C2O)cc1 |
|
~%
(2S,3S,4S,5R,6S... CAS#:21080-66-0 |
| Literature: Bulletin of the Chemical Society of Japan, , vol. 83, # 9 p. 1004 - 1009 |
| Precursor 1 | |
|---|---|
| DownStream 2 | |
| 4-Aminophenyl |A-D-Glucopyranosiduronic Acid |
| 4-Aminophenyl b-D-glucuronide |
| 4-Aminophenyl |A-D-Glucuronide |