ETHYL 2-(5-PHENYL-2H-1,2,3,4-TETRAAZOL-2-YL)ACETATE structure
|
Common Name | ETHYL 2-(5-PHENYL-2H-1,2,3,4-TETRAAZOL-2-YL)ACETATE | ||
|---|---|---|---|---|
| CAS Number | 21054-65-9 | Molecular Weight | 232.23900 | |
| Density | 1.28g/cm3 | Boiling Point | 394.2ºC at 760 mmHg | |
| Molecular Formula | C11H12N4O2 | Melting Point | 83-85ºC | |
| MSDS | N/A | Flash Point | 192.2ºC | |
| Name | ethyl 2-(5-phenyltetrazol-2-yl)acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.28g/cm3 |
|---|---|
| Boiling Point | 394.2ºC at 760 mmHg |
| Melting Point | 83-85ºC |
| Molecular Formula | C11H12N4O2 |
| Molecular Weight | 232.23900 |
| Flash Point | 192.2ºC |
| Exact Mass | 232.09600 |
| PSA | 69.90000 |
| LogP | 0.90320 |
| Vapour Pressure | 2.01E-06mmHg at 25°C |
| Index of Refraction | 1.618 |
| InChIKey | BHAJMSNEZPPNKN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cn1nnc(-c2ccccc2)n1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| (5-Phenyl-tetrazol-2-yl)-acetic acid ethyl ester |
| 5-phenyl-2-tetrazolylacetic acid ethyl ester |
| ethyl 2-(5-phenyl-1,2,3,4-tetraazol-2-yl)acetate |
| ethyl 5-phenyl-2h-tetrazole-2-acetate |
| ethyl 5-phenyl-2H-tetrazolylacetate |
| 5-Phenyl-tetrazolyl-(2)-essigsaeureethylester |
| ethylphenyltetraazolylacetate |
| ethyl-(5-phenyltetrazol-2-yl)acetate |
| ethyl (5-phenyl-2H-tetrazol-2-yl)acetate |