Potassium perfluoroheptanoate structure
|
Common Name | Potassium perfluoroheptanoate | ||
|---|---|---|---|---|
| CAS Number | 21049-36-5 | Molecular Weight | 402.15100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C7F13KO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Potassium perfluoroheptanoate |
|---|
| Molecular Formula | C7F13KO2 |
|---|---|
| Molecular Weight | 402.15100 |
| Exact Mass | 401.93300 |
| PSA | 40.13000 |
| LogP | 2.47510 |
| InChIKey | HSYXZPMOVCRLEQ-UHFFFAOYSA-M |
| SMILES | O=C([O-])C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F.[K+] |
| HS Code | 2915900090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
| HS Code | 2915900090 |
|---|---|
| Summary | 2915900090 other saturated acyclic monocarboxylic acids and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:5.5% General tariff:30.0% |