4-(4-METHYLPHENYL)-1,3-THIAZOLE-2-THIOL structure
|
Common Name | 4-(4-METHYLPHENYL)-1,3-THIAZOLE-2-THIOL | ||
|---|---|---|---|---|
| CAS Number | 2103-92-6 | Molecular Weight | 207.31500 | |
| Density | 1.32g/cm3 | Boiling Point | 347ºC at 760mmHg | |
| Molecular Formula | C10H9NS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 163.7ºC | |
| Name | 4-(4-methylphenyl)-3H-1,3-thiazole-2-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.32g/cm3 |
|---|---|
| Boiling Point | 347ºC at 760mmHg |
| Molecular Formula | C10H9NS2 |
| Molecular Weight | 207.31500 |
| Flash Point | 163.7ºC |
| Exact Mass | 207.01800 |
| PSA | 79.93000 |
| LogP | 3.40720 |
| Vapour Pressure | 5.53E-05mmHg at 25°C |
| Index of Refraction | 1.715 |
| InChIKey | IFHSFJUUGCCKOC-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2csc(=S)[nH]2)cc1 |
| HS Code | 2934100090 |
|---|
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-Mercapto-4-(p-methylphenyl)thiazole |
| 4-p-tolyl-3H-thiazole-2-thione |
| HMS2672H04 |
| 4-(4-methylphenyl)-1,3-thiazole-2-thiol |
| 2-Mercapto-4-p-tolyl-thiazol |
| 4-(4-methylphenyl)-2-mercaptothiazole |
| 2-mercapto-4-(4-methylphenyl)thiazole |