Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate structure
|
Common Name | Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 2102425-25-0 | Molecular Weight | 288.52 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H7BrClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H7BrClNO2 |
|---|---|
| Molecular Weight | 288.52 |
| InChIKey | ALIGKAHUUWGESD-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc2c(Cl)c(Br)[nH]c2c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: The English name of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate. |
| Q: What is the SMILES notation of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: SMILES notation of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is COC(=O)c1ccc2c(Cl)c(Br)[nH]c2c1. |
| Q: What is the molecular weight of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: Molecular weight of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is 288.52. |
| Q: What is the CAS number of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: CAS number of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is 2102425-25-0. |
| Q: What is the Chinese name of 2102425-25-0? |
| A: Chinese name of 2102425-25-0 is 2102425-25-0. |
| Q: What is the InChIKey of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: InChIKey of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is ALIGKAHUUWGESD-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate? |
| A: Molecular formula of Methyl 2-bromo-3-chloro-1H-indole-6-carboxylate is C10H7BrClNO2. |