SPDMB
Modify Date: 2025-08-25 11:33:27
SPDMB structure
|
Common Name | SPDMB | ||
|---|---|---|---|---|
| CAS Number | 2101206-29-3 | Molecular Weight | 340.42 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16N2O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of SPDMBSPDMB is a glutathione cleavable ADC linker used for the antibody-drug conjugate (ADCs)[1]. |
| Name | SPDMB |
|---|
| Description | SPDMB is a glutathione cleavable ADC linker used for the antibody-drug conjugate (ADCs)[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C14H16N2O4S2 |
|---|---|
| Molecular Weight | 340.42 |
| InChIKey | KUSWWWVFHGSSGW-UHFFFAOYSA-N |
| SMILES | CC(C)(CC(=O)ON1C(=O)CCC1=O)SSc1ccccn1 |