2-[(3-Benzoylphenyl)amino]benzoic acid structure
|
Common Name | 2-[(3-Benzoylphenyl)amino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 21003-80-5 | Molecular Weight | 317.33800 | |
| Density | 1.289g/cm3 | Boiling Point | 522.3ºC at 760 mmHg | |
| Molecular Formula | C20H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 269.7ºC | |
| Name | 2-(3-benzoylanilino)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.289g/cm3 |
|---|---|
| Boiling Point | 522.3ºC at 760 mmHg |
| Molecular Formula | C20H15NO3 |
| Molecular Weight | 317.33800 |
| Flash Point | 269.7ºC |
| Exact Mass | 317.10500 |
| PSA | 66.40000 |
| LogP | 4.43240 |
| Vapour Pressure | 9.78E-12mmHg at 25°C |
| Index of Refraction | 1.673 |
| InChIKey | HUEYEAPOFINHSA-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1cccc(Nc2ccccc2C(=O)O)c1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| ANTHRANILIC ACID,N-(3-BENZOYLPHENYL) |
| N-(3-Benzoylphenyl)anthranilic acid |