3-[4-[4-(3-hydroxypropoxy)phenyl]phenoxy]propan-1-ol structure
|
Common Name | 3-[4-[4-(3-hydroxypropoxy)phenyl]phenoxy]propan-1-ol | ||
|---|---|---|---|---|
| CAS Number | 20994-28-9 | Molecular Weight | 302.36500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H22O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3-[4-[4-(3-hydroxypropoxy)phenyl]phenoxy]propan-1-ol |
|---|
| Molecular Formula | C18H22O4 |
|---|---|
| Molecular Weight | 302.36500 |
| Exact Mass | 302.15200 |
| PSA | 58.92000 |
| LogP | 2.87600 |
| InChIKey | SSCPPHAABIGYSY-UHFFFAOYSA-N |
| SMILES | OCCCOc1ccc(-c2ccc(OCCCO)cc2)cc1 |
|
~58%
3-[4-[4-(3-hydr... CAS#:20994-28-9 |
| Literature: Kaminski, Radoslaw; Kowalski, Jaroslaw; Mames, Iwona; Korybut-Daszkiewicz, Bohdan; Domagala, Slawomir; Wozniak, Krzysztof European Journal of Inorganic Chemistry, 2011 , # 4 p. 479 - 488 |
|
~37%
3-[4-[4-(3-hydr... CAS#:20994-28-9 |
| Literature: Roetz, U.; Lindau, J.; Weissflog, W.; Reinhold, G.; Unseld, W.; Kuschel, F. Molecular Crystals and Liquid Crystals (1969-1991), 1989 , vol. 170, p. 185 - 194 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |