1,3-Dimethyl-8-nitro-3,7-dihydro-1H-purine-2,6-dione structure
|
Common Name | 1,3-Dimethyl-8-nitro-3,7-dihydro-1H-purine-2,6-dione | ||
|---|---|---|---|---|
| CAS Number | 2099-73-2 | Molecular Weight | 225.16200 | |
| Density | 1.67g/cm3 | Boiling Point | 535ºC at 760mmHg | |
| Molecular Formula | C7H7N5O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 277.4ºC | |
| Name | 1,3-dimethyl-8-nitro-7H-purine-2,6-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.67g/cm3 |
|---|---|
| Boiling Point | 535ºC at 760mmHg |
| Molecular Formula | C7H7N5O4 |
| Molecular Weight | 225.16200 |
| Flash Point | 277.4ºC |
| Exact Mass | 225.05000 |
| PSA | 118.50000 |
| Vapour Pressure | 1.6E-11mmHg at 25°C |
| Index of Refraction | 1.659 |
| InChIKey | ZWBASWPKNUWUSZ-UHFFFAOYSA-N |
| SMILES | Cn1c(=O)c2[nH]c([N+](=O)[O-])nc2n(C)c1=O |
| HS Code | 2933990090 |
|---|
|
~75%
1,3-Dimethyl-8-... CAS#:2099-73-2 |
| Literature: Mosselhi; Pfleiderer Journal of Heterocyclic Chemistry, 1993 , vol. 30, # 5 p. 1221 - 1228 |
| Precursor 1 | |
|---|---|
| DownStream 10 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1,3-Dimethyl-8-nitro-3,7-dihydro-1H-purine-2,6-dione |
| 2-Nitrotheophylline |
| 1,3-dimethyl-8-nitro-2,3,6,7-tetrahydro-1H-purine-2,6-dione hydrate |
| 1,3-Dimethyl-8-nitro-3,7-dihydro-purin-2,6-dion |
| 8-Nitro-theophyllin |
| 1,3-dimethyl-8-nitroxanthine |
| 8-nitrotheophylline |
| 1,3-dimethyl-8-nitro-3,7(9)-dihydro-purine-2,6-dione |
| 1,3-Dimethyl-8-nitro-1H-purine-2,6(3H,9H)-dione |