3-Phenylpropionylglycine structure
|
Common Name | 3-Phenylpropionylglycine | ||
|---|---|---|---|---|
| CAS Number | 20989-69-9 | Molecular Weight | 243.68700 | |
| Density | N/A | Boiling Point | 403.7ºC at 760 mmHg | |
| Molecular Formula | C11H14ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 198ºC | |
| Name | 2-(3-phenylpropanoylamino)acetic acid |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 403.7ºC at 760 mmHg |
|---|---|
| Molecular Formula | C11H14ClNO3 |
| Molecular Weight | 243.68700 |
| Flash Point | 198ºC |
| Exact Mass | 243.06600 |
| PSA | 66.40000 |
| LogP | 2.12650 |
| Vapour Pressure | 3.05E-07mmHg at 25°C |
| InChIKey | OWFICUKLRVRHCX-UHFFFAOYSA-N |
| SMILES | Cl.O=C(O)CNCCC(=O)c1ccccc1 |
| HS Code | 2922509090 |
|---|
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| HYDROCINNAMOYLGLYCINE |
| Phenylpropionylglycine |