Tafluprost ethyl ester
Modify Date: 2025-09-18 17:05:57
Tafluprost ethyl ester structure
|
Common Name | Tafluprost ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 209860-89-9 | Molecular Weight | 438.505 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 546.6±50.0 °C at 760 mmHg | |
| Molecular Formula | C24H32F2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 284.4±30.1 °C | |
Use of Tafluprost ethyl esterTafluprost ethyl ester is a form of tafluprost which may have increased lipid solubility compared to the free acid. |
| Name | Tafluprost ethyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 546.6±50.0 °C at 760 mmHg |
| Molecular Formula | C24H32F2O5 |
| Molecular Weight | 438.505 |
| Flash Point | 284.4±30.1 °C |
| Exact Mass | 438.221771 |
| PSA | 75.99000 |
| LogP | 3.88 |
| Vapour Pressure | 0.0±1.5 mmHg at 25°C |
| Index of Refraction | 1.553 |
| InChIKey | SPWJIEVPQKMQPO-MSHHKXPZSA-N |
| SMILES | CCOC(=O)CCCC=CCC1C(O)CC(O)C1C=CC(F)(F)COc1ccccc1 |
| Ethyl (5Z)-7-{(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl}-5-heptenoate |
| 5-Heptenoic acid, 7-[(1R,2R,3R,5S)-2-[(1E)-3,3-difluoro-4-phenoxy-1-buten-1-yl]-3,5-dihydroxycyclopentyl]-, ethyl ester, (5Z)- |