1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine
Modify Date: 2026-07-02 14:22:33
![1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine Structure](https://www.chemsrc.com/extcaspic/056/2097857-89-9.png)
1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine structure
|
Common Name | 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine | ||
|---|---|---|---|---|
| CAS Number | 2097857-89-9 | Molecular Weight | 234.22 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13F3N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13F3N2O |
|---|---|
| Molecular Weight | 234.22 |
| InChIKey | BEVNGECAHZUHPD-UHFFFAOYSA-N |
| SMILES | FC(F)(F)C1CCN(Cc2cocn2)CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: The English name of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine. |
| Q: What is the CAS number of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: CAS number of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is 2097857-89-9. |
| Q: What is the InChIKey of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: InChIKey of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is BEVNGECAHZUHPD-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: SMILES notation of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is FC(F)(F)C1CCN(Cc2cocn2)CC1. |
| Q: What is the molecular weight of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: Molecular weight of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is 234.22. |
| Q: What is the Chinese name of 2097857-89-9? |
| A: Chinese name of 2097857-89-9 is 2097857-89-9. |
| Q: What is the molecular formula of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine? |
| A: Molecular formula of 1-[(1,3-Oxazol-4-yl)methyl]-4-(trifluoromethyl)piperidine is C10H13F3N2O. |