5,7-dibromo-6-hydroxy-chroman-2-one
Modify Date: 2025-09-23 05:33:24
5,7-dibromo-6-hydroxy-chroman-2-one structure
|
Common Name | 5,7-dibromo-6-hydroxy-chroman-2-one | ||
|---|---|---|---|---|
| CAS Number | 20978-36-3 | Molecular Weight | 321.95000 | |
| Density | 2.082g/cm3 | Boiling Point | 372.7ºC at 760 mmHg | |
| Molecular Formula | C9H6Br2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 179.2ºC | |
| Name | 5,7-dibromo-6-hydroxy-3,4-dihydrochromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 2.082g/cm3 |
|---|---|
| Boiling Point | 372.7ºC at 760 mmHg |
| Molecular Formula | C9H6Br2O3 |
| Molecular Weight | 321.95000 |
| Flash Point | 179.2ºC |
| Exact Mass | 319.86800 |
| PSA | 46.53000 |
| LogP | 2.76880 |
| Vapour Pressure | 4.41E-06mmHg at 25°C |
| Index of Refraction | 1.665 |
| InChIKey | NLKWEXHSUNLDSS-UHFFFAOYSA-N |
| SMILES | O=C1CCc2c(cc(Br)c(O)c2Br)O1 |
|
~%
5,7-dibromo-6-h... CAS#:20978-36-3 |
| Literature: Schmir et al. Journal of the American Chemical Society, 1959 , vol. 81, p. 2228,2232 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 5,7-dibromo-6-hydroxy-3,4-dihydro-2H-chromen-2-one |
| 3,4-Dihydrocoumarin,5,7-dibromo-6-hydroxy |
| 5,7-Dibrom-6-hydroxy-chroman-2-on |
| Coumarin-6-ol,5,7-dibromo-3,4-dihydro |
| 5.7-Dibrom-6-hydroxyhydrocumarin |
| 5,7-dibromo-6-hydroxy-chroman-2-one |