C2 Ceramide (d14:1/2:0)
Modify Date: 2025-09-21 23:34:34
C2 Ceramide (d14:1/2:0) structure
|
Common Name | C2 Ceramide (d14:1/2:0) | ||
|---|---|---|---|---|
| CAS Number | 2097561-20-9 | Molecular Weight | 285.422 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 489.9±45.0 °C at 760 mmHg | |
| Molecular Formula | C16H31NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 250.1±28.7 °C | |
Use of C2 Ceramide (d14:1/2:0)C2 Ceramide (d14:1/2:0) is a bioactive sphingolipid. |
| Name | C2 Ceramide (d14:1/2:0) |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 489.9±45.0 °C at 760 mmHg |
| Molecular Formula | C16H31NO3 |
| Molecular Weight | 285.422 |
| Flash Point | 250.1±28.7 °C |
| Exact Mass | 285.230408 |
| LogP | 3.77 |
| Vapour Pressure | 0.0±2.8 mmHg at 25°C |
| Index of Refraction | 1.487 |
| InChIKey | CJDUQSUHEWFQMO-HMUVLFPJSA-N |
| SMILES | CCCCCCCCCC=CC(O)C(CO)NC(C)=O |
| C2 Ceramide (d14:1/2:0) |
| Acetamide, N-[(1S,2R,3E)-2-hydroxy-1-(hydroxymethyl)-3-tridecen-1-yl]- |
| N-[(2S,3R,4E)-1,3-Dihydroxy-4-tetradecen-2-yl]acetamide |