methindione
Modify Date: 2024-02-03 10:04:54
methindione structure
|
Common Name | methindione | ||
|---|---|---|---|---|
| CAS Number | 20915-57-5 | Molecular Weight | 203.23700 | |
| Density | 1.18g/cm3 | Boiling Point | 347.3ºC at 760 mmHg | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 144.7ºC | |
| Name | 2-ethyl-2-(methylamino)indene-1,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 347.3ºC at 760 mmHg |
| Molecular Formula | C12H13NO2 |
| Molecular Weight | 203.23700 |
| Flash Point | 144.7ºC |
| Exact Mass | 203.09500 |
| PSA | 46.17000 |
| LogP | 1.82470 |
| Vapour Pressure | 5.44E-05mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | LDYGJOOHMBDCHE-UHFFFAOYSA-N |
| SMILES | CCC1(NC)C(=O)c2ccccc2C1=O |
| HS Code | 2922399090 |
|---|
| HS Code | 2922399090 |
|---|---|
| Summary | 2922399090 other amino-aldehydes, amino-ketones and amino-quinones, other than those containing more than one kind of oxygen function; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Methindione |
| 2-Methylamino-2-aethyl-indan-1,3-dion |
| 2-Methylamino-2-ethyl-1,3-indandion |
| 2-Aethyl-2-methylamino-indan-1.3-dion |
| 2-Ethyl-2-methylaminoindan-1,3-dione |
| 2-Aethyl-2-methylamino-1.3-indandion |
| 2-Methyloamino-2-aethyloindandion-1,3 |
| 2-Methylamino-2-ethylindan-1,3-dion |
| 2-Methylamino-2-ethyl-1,3-indanedione |