diethyl 2,4-bis(diethylamino)cyclobuta-1,3-diene-1,3-dicarboxylate structure
|
Common Name | diethyl 2,4-bis(diethylamino)cyclobuta-1,3-diene-1,3-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 20913-35-3 | Molecular Weight | 338.44200 | |
| Density | 1.08g/cm3 | Boiling Point | 380.5ºC at 760mmHg | |
| Molecular Formula | C18H30N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 183.9ºC | |
| Name | diethyl 2,4-bis(diethylamino)cyclobuta-1,3-diene-1,3-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.08g/cm3 |
|---|---|
| Boiling Point | 380.5ºC at 760mmHg |
| Molecular Formula | C18H30N2O4 |
| Molecular Weight | 338.44200 |
| Flash Point | 183.9ºC |
| Exact Mass | 338.22100 |
| PSA | 59.08000 |
| LogP | 2.31800 |
| Vapour Pressure | 5.42E-06mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | RHFCLUSXAFYMQB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N(CC)CC)C(C(=O)OCC)=C1N(CC)CC |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 2,4-Bis-diethylamino-cyclobutadien-1,3-dicarbonsaeure-diethylester |