9,9-dimethyl-3-phenyl-7-oxa-9-azoniabicyclo[3.3.1]non-3-ene structure
|
Common Name | 9,9-dimethyl-3-phenyl-7-oxa-9-azoniabicyclo[3.3.1]non-3-ene | ||
|---|---|---|---|---|
| CAS Number | 20893-57-6 | Molecular Weight | 357.23000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20INO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 9,9-dimethyl-7-phenyl-3-oxa-9-azoniabicyclo[3.3.1]non-6-ene,iodide |
|---|
| Molecular Formula | C15H20INO |
|---|---|
| Molecular Weight | 357.23000 |
| Exact Mass | 357.05900 |
| PSA | 9.23000 |
| InChIKey | GTTAEUUYLQJDMR-UHFFFAOYSA-M |
| SMILES | C[N+]1(C)C2C=C(c3ccccc3)CC1COC2.[I-] |
|
~%
9,9-dimethyl-3-... CAS#:20893-57-6 |
| Literature: Paquette,L.A. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 6148 - 6153 |
|
~%
9,9-dimethyl-3-... CAS#:20893-57-6 |
| Literature: Paquette,L.A. et al. Journal of the American Chemical Society, 1968 , vol. 90, p. 6148 - 6153 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |