BP Lipid 135 structure
|
Common Name | BP Lipid 135 | ||
|---|---|---|---|---|
| CAS Number | 2089251-35-2 | Molecular Weight | 724.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H89NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BP Lipid 135BP Lipid 135 is a cationieally ionizable lipid. BP Lipid 135 can be used to prepare lipid nanoparticles (LNP) (WO2022218503A1)[1]. |
| Name | BP Lipid 135 |
|---|
| Description | BP Lipid 135 is a cationieally ionizable lipid. BP Lipid 135 can be used to prepare lipid nanoparticles (LNP) (WO2022218503A1)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C45H89NO5 |
|---|---|
| Molecular Weight | 724.19 |
| InChIKey | DSNJXBBGALIZJN-UHFFFAOYSA-N |
| SMILES | CCCCCCCCCOC(=O)CCCCCCCN(CCCO)CCCCCCCC(=O)OC(CCCCCCCC)CCCCCCCC |