Azido-PEG3-methyl ester
Modify Date: 2025-08-26 18:32:03
Azido-PEG3-methyl ester structure
|
Common Name | Azido-PEG3-methyl ester | ||
|---|---|---|---|---|
| CAS Number | 2086689-07-6 | Molecular Weight | 261.27 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19N3O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Azido-PEG3-methyl esterAzido-PEG3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | Azido-PEG3-methyl ester |
|---|
| Description | Azido-PEG3-methyl ester is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C10H19N3O5 |
|---|---|
| Molecular Weight | 261.27 |
| InChIKey | OEJNDRBQIKCJBR-UHFFFAOYSA-N |
| SMILES | COC(=O)CCOCCOCCOCCN=[N+]=[N-] |