N-(Azido-PEG2)-N-Fluorescein-PEG4-acid structure
|
Common Name | N-(Azido-PEG2)-N-Fluorescein-PEG4-acid | ||
|---|---|---|---|---|
| CAS Number | 2086689-06-5 | Molecular Weight | 811.855 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C38H45N5O13S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-(Azido-PEG2)-N-Fluorescein-PEG4-acidN-(Azido-PEG2)-N-Fluorescein-PEG4-acid is a fluorescein dye derivative containing a terminal azide group and a terminal carboxylic acid. The azide group enables PEGylation via Click Chemistry. The terminal carboxylic acid can be reacted with primary amino groups in the presence of activators (e.g. EDC, or DCC) to form a stable amide bond. |
| Name | 1-Azido-9-[(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)carbamothioyl]-3,6,12,15,18,21-hexaoxa-9-azatetracosan-24-oic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C38H45N5O13S |
|---|---|
| Molecular Weight | 811.855 |
| Exact Mass | 811.273438 |
| LogP | 0.48 |
| InChIKey | NJEUQTQEGQWTHD-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCCOCCOCCN(CCOCCOCCOCCOCCC(=O)O)C(=S)Nc1ccc2c(c1)C(=O)OC21c2ccc(O)cc2Oc2cc(O)ccc21 |
| 1-Azido-9-[(3',6'-dihydroxy-3-oxo-3H-spiro[2-benzofuran-1,9'-xanthen]-5-yl)carbamothioyl]-3,6,12,15,18,21-hexaoxa-9-azatetracosan-24-oic acid |
| 3,6,12,15,18,21-Hexaoxa-9-azatetracosan-24-oic acid, 1-azido-9-[[(3',6'-dihydroxy-3-oxospiro[isobenzofuran-1(3H),9'-[9H]xanthen]-5-yl)amino]thioxomethyl]- |