MMP-3 Inhibitor VIII
Modify Date: 2025-08-25 16:12:32
MMP-3 Inhibitor VIII structure
|
Common Name | MMP-3 Inhibitor VIII | ||
|---|---|---|---|---|
| CAS Number | 208663-26-7 | Molecular Weight | 406.496 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C20H26N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of MMP-3 Inhibitor VIIIMMP-3 inhibitor VIII is a cell permeable sulfonamide-based hydroxamic acid that binds to the active site of MMP-3 (Ki = 23 nM) and prevents its activity. |
| Name | N2-Benzyl-N-hydroxy-N2-[(4-methoxyphenyl)sulfonyl]leucinamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Molecular Formula | C20H26N2O5S |
| Molecular Weight | 406.496 |
| Exact Mass | 406.156250 |
| LogP | 4.34 |
| Index of Refraction | 1.577 |
| InChIKey | VKUYLANQOAKALN-UHFFFAOYSA-N |
| SMILES | COc1ccc(S(=O)(=O)N(Cc2ccccc2)C(CC(C)C)C(=O)NO)cc1 |
| N2-Benzyl-N-hydroxy-N2-[(4-methoxyphenyl)sulfonyl]leucinamide |
| Pentanamide, N-hydroxy-2-[[(4-methoxyphenyl)sulfonyl](phenylmethyl)amino]-4-methyl- |