Cauloside C
Modify Date: 2025-08-25 21:32:34
Cauloside C structure
|
Common Name | Cauloside C | ||
|---|---|---|---|---|
| CAS Number | 20853-58-1 | Molecular Weight | 766.95500 | |
| Density | 1.35±0.1 g/cm3(Predicted) | Boiling Point | 881.9±65.0 °C(Predicted) | |
| Molecular Formula | C41H66O13 | Melting Point | 252-255 °C | |
| MSDS | N/A | Flash Point | N/A | |
Use of Cauloside CCauloside C is a triterpene glycoside isolated from Caulophyllum robustum Max. Cauloside C exerts anti-inflammatory effects through the inhibition of expression of iNOS and proinflammatory cytokines[1]. |
| Name | Calthosid D |
|---|
| Description | Cauloside C is a triterpene glycoside isolated from Caulophyllum robustum Max. Cauloside C exerts anti-inflammatory effects through the inhibition of expression of iNOS and proinflammatory cytokines[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.35±0.1 g/cm3(Predicted) |
|---|---|
| Boiling Point | 881.9±65.0 °C(Predicted) |
| Melting Point | 252-255 °C |
| Molecular Formula | C41H66O13 |
| Molecular Weight | 766.95500 |
| Exact Mass | 766.45000 |
| PSA | 215.83000 |
| LogP | 2.49350 |
| InChIKey | RROGHRHLBLVQSG-UUWFFIQNSA-N |
| SMILES | CC1(C)CCC2(C(=O)O)CCC3(C)C(=CCC4C5(C)CCC(OC6OCC(O)C(O)C6OC6OC(CO)C(O)C(O)C6O)C(C)(CO)C5CCC43C)C2C1 |