Carbonic acid ethyl 4-trifluoromethyl-2-nitrophenyl ester
Modify Date: 2025-10-05 07:38:13
Carbonic acid ethyl 4-trifluoromethyl-2-nitrophenyl ester structure
|
Common Name | Carbonic acid ethyl 4-trifluoromethyl-2-nitrophenyl ester | ||
|---|---|---|---|---|
| CAS Number | 20852-49-7 | Molecular Weight | 279.16900 | |
| Density | 1.429g/cm3 | Boiling Point | 317.6ºC at 760 mmHg | |
| Molecular Formula | C10H8F3NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.9ºC | |
| Name | ethyl [2-nitro-4-(trifluoromethyl)phenyl] carbonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.429g/cm3 |
|---|---|
| Boiling Point | 317.6ºC at 760 mmHg |
| Molecular Formula | C10H8F3NO5 |
| Molecular Weight | 279.16900 |
| Flash Point | 145.9ºC |
| Exact Mass | 279.03500 |
| PSA | 81.35000 |
| LogP | 3.67210 |
| Vapour Pressure | 0.000382mmHg at 25°C |
| Index of Refraction | 1.48 |
| InChIKey | PZTSFDBDXHHPJQ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1ccc(C(F)(F)F)cc1[N+](=O)[O-] |
| HS Code | 2920909090 |
|---|
|
~%
Carbonic acid e... CAS#:20852-49-7 |
| Literature: Sam; Valentine; Richmond Journal of pharmaceutical sciences, 1968 , vol. 57, # 10 p. 1763 - 1768 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
![[2-amino-4-(trifluoromethyl)phenyl] ethyl carbonate structure](https://image.chemsrc.com/caspic/261/19420-45-2.png)
CAS#:19420-45-2| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-Nitro-4-trifluormethylphenyl ethyl carbonat |