4-Chloro-5-phenyl-1H-pyrrolo[2,3-d]pyrimidine structure
|
Common Name | 4-Chloro-5-phenyl-1H-pyrrolo[2,3-d]pyrimidine | ||
|---|---|---|---|---|
| CAS Number | 208459-81-8 | Molecular Weight | 229.665 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 369.7±52.0 °C(Predicted) | |
| Molecular Formula | C12H8ClN3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-Chloro-5-phenyl-7H-pyrrolo[2,3-d]pyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 369.7±52.0 °C(Predicted) |
| Molecular Formula | C12H8ClN3 |
| Molecular Weight | 229.665 |
| Exact Mass | 229.040680 |
| PSA | 41.57000 |
| LogP | 2.78 |
| Index of Refraction | 1.703 |
| InChIKey | YDDOENFAKYOBJS-UHFFFAOYSA-N |
| SMILES | Clc1ncnc2[nH]cc(-c3ccccc3)c12 |
|
~84%
4-Chloro-5-phen... CAS#:208459-81-8 |
| Literature: Bookser, Brett C.; Ugarkar, Bheemarao G.; Matelich, Michael C.; Lemus, Robert H.; Allan, Matthew; Tsuchiya, Megumi; Nakane, Masami; Nagahisa, Atsushi; Wiesner, James B.; Erion, Mark D. Journal of Medicinal Chemistry, 2005 , vol. 48, # 24 p. 7808 - 7820 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 7H-Pyrrolo[2,3-d]pyrimidine, 4-chloro-5-phenyl- |
| 4-Chloro-5-phenyl-1H-pyrrolo[2,3-d]pyrimidine |