PARP1-IN-7 structure
|
Common Name | PARP1-IN-7 | ||
|---|---|---|---|---|
| CAS Number | 2084112-75-2 | Molecular Weight | 397.47 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H23N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PARP1-IN-7PARP1-IN-7 is an inhibitor of poly(ADP-ribose) polymerase-1 (PARP1) as an anticancer agent. |
| Name | PARP1-IN-7 |
|---|
| Description | PARP1-IN-7 is an inhibitor of poly(ADP-ribose) polymerase-1 (PARP1) as an anticancer agent. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C24H23N5O |
|---|---|
| Molecular Weight | 397.47 |
| InChIKey | IBBZXRLLZKUNIM-HXUWFJFHSA-N |
| SMILES | N#Cc1ccc(N2CCN(C3C=C(c4cc5ncccc5c(=O)[nH]4)CC3)CC2)cc1 |