methylripariochromene A
Modify Date: 2025-08-26 17:26:10
methylripariochromene A structure
|
Common Name | methylripariochromene A | ||
|---|---|---|---|---|
| CAS Number | 20819-46-9 | Molecular Weight | 262.30100 | |
| Density | 1.099g/cm3 | Boiling Point | 385.4ºC at 760 mmHg | |
| Molecular Formula | C15H18O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 169.8ºC | |
| Name | 1-(7,8-dimethoxy-2,2-dimethylchromen-6-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.099g/cm3 |
|---|---|
| Boiling Point | 385.4ºC at 760 mmHg |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30100 |
| Flash Point | 169.8ºC |
| Exact Mass | 262.12100 |
| PSA | 44.76000 |
| LogP | 3.09060 |
| Vapour Pressure | 3.82E-06mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | AVQQLPJWGXTKFZ-UHFFFAOYSA-N |
| SMILES | COc1c(C(C)=O)cc2c(c1OC)OC(C)(C)C=C2 |
| HS Code | 2914509090 |
|---|
| HS Code | 2914509090 |
|---|---|
| Summary | HS:2914509090 other ketones with other oxygen function VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| Methylripariochromen A |
| 6-acetyl-7,8-dimethoxy-2,2-dimethylchromene |
| Methylrepariochromen A |
| Methylripariochromene A |